benzenebutanoic acid, 4-methyl-β-oxo-, ethyl ester

benzenebutanoic acid, 4-methyl-β-oxo-, ethyl ester - Names and Identifiers

Name	ethyl 3-oxo-4-(p-tolyl)butanoate
Synonyms	LogP Ethyl 3-oxo-4-(p-tolyl)butanoate ethyl 3-oxo-4-(p-tolyl)butanoate Ethyl 4-(4-methylphenyl)-3-oxobutanoate ethyl 4-(4-methylphenyl)-3-oxobutanoate 3-Oxo-4-P-Tolyl-Butyric Acid Ethyl Ester 3-OXO-4-P-TOLYL-BUTYRIC ACID ETHYL ESTER 4-Methyl-b-oxo-benzenebutanoic acid ethyl ester 4-(4-methylphenyl)-3-oxobutanoic acid ethyl ester benzenebutanoic acid, 4-methyl-β-oxo-, ethyl ester Benzenebutanoic acid, 4-methyl-β-oxo-, ethyl ester
CAS	62135-86-8
InChI	InChI=1/C13H16O3/c1-3-16-13(15)9-12(14)8-11-6-4-10(2)5-7-11/h4-7H,3,8-9H2,1-2H3

benzenebutanoic acid, 4-methyl-β-oxo-, ethyl ester - Physico-chemical Properties

Molecular Formula	C13H16O3
Molar Mass	220.26
Density	1.073g/cm³
Boling Point	309.2°C at 760 mmHg
Flash Point	132.8°C
Vapor Presure	0.000648mmHg at 25°C
Refractive Index	1.506

benzenebutanoic acid, 4-methyl-β-oxo-, ethyl ester - Introduction

Ethyl 3-oxo-4-(p-tolyl)butanoate, also known as ethyl 3-oxo-4-(p-tolyl) butyrate, is an organic compound. It has the following properties:

1. appearance: ethyl 3-oxo-4-(p-tolyl)butanoate is a colorless to pale yellow liquid.
2. Solubility: It is soluble in organic solvents, such as alcohols and ethers, but insoluble in water.

In the laboratory and industry, ethyl 3-oxo-4-(p-tolyl)butanoate has the following uses:

1. Synthesis: The compound can be used as a raw material for the synthesis of other important organic compounds, such as drugs, fragrances and dyes.
2. spices: it has a fragrant smell, commonly used as perfume and cosmetics in the fragrance ingredients.

ethyl 3-oxo-4-(p-tolyl)butanoate is prepared as follows:

1. material preparation: alcohol solvent, acid catalyst and appropriate amount of oxoacetate are added into the reaction vessel.
2. Reaction conditions: The esterification reaction is carried out at an appropriate temperature and reaction time.
3. Crystallization and purification: The target product is obtained through crystallization, purification and other steps.

Regarding safety information, ethyl 3-oxo-4-(p-tolyl)butanoate is a chemical whose potential hazards include:

1. Irritation: May cause irritation to eyes, skin and respiratory system.
2. toxicity: at high concentrations may produce toxic effects on the human body.
3. combustion hazard: it is a flammable liquid, if contact with the fire source may cause a fire.

Therefore, appropriate safety measures must be taken when using or handling ethyl 3-oxo-4-(p-tolyl)butanoate, such as wearing appropriate protective clothing and respirators, and ensuring that the operating area is well ventilated.

Last Update：2024-04-09 20:48:19